JezK
Edit File: jquery.nicescroll.js
/* jquery.nicescroll -- version 3.5.0 BETA5 -- copyright 2011-12-13 InuYaksa*2013 -- licensed under the MIT -- -- http://areaaperta.com/nicescroll -- https://github.com/inuyaksa/jquery.nicescroll -- */ (function(jQuery){ // globals var domfocus = false; var mousefocus = false; var zoomactive = false; var tabindexcounter = 5000; var ascrailcounter = 2000; var globalmaxzindex = 0; var $ = jQuery; // sandbox // http://stackoverflow.com/questions/2161159/get-script-path function getScriptPath() { var scripts=document.getElementsByTagName('script'); var path=scripts[scripts.length-1].src.split('?')[0]; return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : ''; } var scriptpath = getScriptPath(); var vendors = ['ms','moz','webkit','o']; var setAnimationFrame = window.requestAnimationFrame||false; var clearAnimationFrame = window.cancelAnimationFrame||false; if (!setAnimationFrame) { for(var vx in vendors) { var v = vendors[vx]; if (!setAnimationFrame) setAnimationFrame = window[v+'RequestAnimationFrame']; if (!clearAnimationFrame) clearAnimationFrame = window[v+'CancelAnimationFrame']||window[v+'CancelRequestAnimationFrame']; } } var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false; var _globaloptions = { zindex:"auto", cursoropacitymin:0, cursoropacitymax:1, cursorcolor:"#424242", cursorwidth:"5px", cursorborder:"1px solid #fff", cursorborderradius:"5px", scrollspeed:60, mousescrollstep:8*3, touchbehavior:false, hwacceleration:true, usetransition:true, boxzoom:false, dblclickzoom:true, gesturezoom:true, grabcursorenabled:true, autohidemode:true, background:"", iframeautoresize:true, cursorminheight:32, preservenativescrolling:true, railoffset:false, bouncescroll:true, spacebarenabled:true, railpadding:{top:0,right:0,left:0,bottom:0}, disableoutline:true, horizrailenabled:true, railalign:"right", railvalign:"bottom", enabletranslate3d:true, enablemousewheel:true, enablekeyboard:true, smoothscroll:true, sensitiverail:true, enablemouselockapi:true, // cursormaxheight:false, cursorfixedheight:false, directionlockdeadzone:6, hidecursordelay:400, nativeparentscrolling:true, enablescrollonselection:true, overflowx:true, overflowy:true, cursordragspeed:0.3, rtlmode:false, cursordragontouch:false, oneaxismousemode:"auto" } var browserdetected = false; var getBrowserDetection = function() { if (browserdetected) return browserdetected; var domtest = document.createElement('DIV'); var d = {}; d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document; d.isopera = ("opera" in window); d.isopera12 = (d.isopera&&("getUserMedia" in navigator)); d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]"); d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera); d.isieold = (d.isie && !("msInterpolationMode" in domtest.style)); // IE6 and older d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(document.documentMode==7)); d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8); d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9); d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10); d.isie9mobile = /iemobile.9/i.test(navigator.userAgent); //wp 7.1 mango if (d.isie9mobile) d.isie9 = false; d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent); //wp 7.0 d.ismozilla = ("MozAppearance" in domtest.style); d.iswebkit = ("WebkitAppearance" in domtest.style); d.ischrome = ("chrome" in window); d.ischrome22 = (d.ischrome&&d.haspointerlock); d.ischrome26 = (d.ischrome&&("transition" in domtest.style)); // issue with transform detection (maintain prefix) d.cantouch = ("ontouchstart" in document.documentElement)||("ontouchstart" in window); // detection for Chrome Touch Emulation d.hasmstouch = (window.navigator.msPointerEnabled||false); // IE10+ pointer events d.ismac = /^mac$/i.test(navigator.platform); d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform)); d.isios4 = ((d.isios)&&!("seal" in Object)); d.isandroid = (/android/i.test(navigator.userAgent)); d.trstyle = false; d.hastransform = false; d.hastranslate3d = false; d.transitionstyle = false; d.hastransition = false; d.transitionend = false; var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform']; for(var a=0;a<check.length;a++){ if (typeof domtest.style[check[a]] != "undefined") { d.trstyle = check[a]; break; } } d.hastransform = (d.trstyle != false); if (d.hastransform) { domtest.style[d.trstyle] = "translate3d(1px,2px,3px)"; d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]); } d.transitionstyle = false; d.prefixstyle = ''; d.transitionend = false; var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition']; var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-']; var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd']; for(var a=0;a<check.length;a++) { if (check[a] in domtest.style) { d.transitionstyle = check[a]; d.prefixstyle = prefix[a]; d.transitionend = evs[a]; break; } } if (d.ischrome26) { // use always prefix d.prefixstyle = prefix[1]; } d.hastransition = (d.transitionstyle); function detectCursorGrab() { var lst = ['-moz-grab','-webkit-grab','grab']; if ((d.ischrome&&!d.ischrome22)||d.isie) lst=[]; // force setting for IE returns false positive and chrome cursor bug for(var a=0;a<lst.length;a++) { var p = lst[a]; domtest.style['cursor']=p; if (domtest.style['cursor']==p) return p; } return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize'; // thank you google for custom cursor! } d.cursorgrabvalue = detectCursorGrab(); d.hasmousecapture = ("setCapture" in domtest); d.hasMutationObserver = (clsMutationObserver !== false); domtest = null; //memory released browserdetected = d; return d; } var NiceScrollClass = function(myopt,me) { var self = this; this.version = '3.5.0 BETA5'; this.name = 'nicescroll'; this.me = me; this.opt = { doc:$("body"), win:false }; $.extend(this.opt,_globaloptions); // Options for internal use this.opt.snapbackspeed = 80; if (myopt||false) { for(var a in self.opt) { if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a]; } } this.doc = self.opt.doc; this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':''; this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName); this.haswrapper = (self.opt.win!==false); this.win = self.opt.win||(this.ispage?$(window):this.doc); this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win; this.body = $("body"); this.viewport = false; this.isfixed = false; this.iframe = false; this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); this.forcescreen = false; //force to use screen position on events this.canshowonmouseevent = (self.opt.autohidemode!="scroll"); // Events jump table this.onmousedown = false; this.onmouseup = false; this.onmousemove = false; this.onmousewheel = false; this.onkeypress = false; this.ongesturezoom = false; this.onclick = false; // Nicescroll custom events this.onscrollstart = false; this.onscrollend = false; this.onscrollcancel = false; this.onzoomin = false; this.onzoomout = false; // Let's start! this.view = false; this.page = false; this.scroll = {x:0,y:0}; this.scrollratio = {x:0,y:0}; this.cursorheight = 20; this.scrollvaluemax = 0; this.checkrtlmode = false; this.scrollrunning = false; this.scrollmom = false; this.observer = false; this.observerremover = false; // observer on parent for remove detection do { this.id = "ascrail"+(ascrailcounter++); } while (document.getElementById(this.id)); this.rail = false; this.cursor = false; this.cursorfreezed = false; this.selectiondrag = false; this.zoom = false; this.zoomactive = false; this.hasfocus = false; this.hasmousefocus = false; this.visibility = true; this.locked = false; this.hidden = false; // rails always hidden this.cursoractive = true; // user can interact with cursors this.overflowx = self.opt.overflowx; this.overflowy = self.opt.overflowy; this.nativescrollingarea = false; this.checkarea = 0; this.events = []; // event list for unbind this.saved = {}; this.delaylist = {}; this.synclist = {}; this.lastdeltax = 0; this.lastdeltay = 0; this.detected = getBrowserDetection(); var cap = $.extend({},this.detected); this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration); this.ishwscroll = (this.canhwscroll&&self.haswrapper); this.istouchcapable = false; // desktop devices with touch screen support //## Check Chrome desktop with touch support if (cap.cantouch&&cap.ischrome&&!cap.isios&&!cap.isandroid) { this.istouchcapable = true; cap.cantouch = false; // parse normal desktop events } //## Firefox 18 nightly build (desktop) false positive (or desktop with touch support) if (cap.cantouch&&cap.ismozilla&&!cap.isios&&!cap.isandroid) { this.istouchcapable = true; cap.cantouch = false; // parse normal desktop events } //## disable MouseLock API on user request if (!self.opt.enablemouselockapi) { cap.hasmousecapture = false; cap.haspointerlock = false; } this.delayed = function(name,fn,tm,lazy) { var dd = self.delaylist[name]; var nw = (new Date()).getTime(); if (!lazy&&dd&&dd.tt) return false; if (dd&&dd.tt) clearTimeout(dd.tt); if (dd&&dd.last+tm>nw&&!dd.tt) { self.delaylist[name] = { last:nw+tm, tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm) } } else if (!dd||!dd.tt) { self.delaylist[name] = { last:nw, tt:0 } setTimeout(function(){fn.call();},0); } }; this.debounced = function(name,fn,tm) { var dd = self.delaylist[name]; var nw = (new Date()).getTime(); self.delaylist[name] = fn; if (!dd) { setTimeout(function(){var fn=self.delaylist[name];self.delaylist[name]=false;fn.call();},tm); } } this.synched = function(name,fn) { function requestSync() { if (self.onsync) return; setAnimationFrame(function(){ self.onsync = false; for(name in self.synclist){ var fn = self.synclist[name]; if (fn) fn.call(self); self.synclist[name] = false; } }); self.onsync = true; }; self.synclist[name] = fn; requestSync(); return name; }; this.unsynched = function(name) { if (self.synclist[name]) self.synclist[name] = false; } this.css = function(el,pars) { // save & set for(var n in pars) { self.saved.css.push([el,n,el.css(n)]); el.css(n,pars[n]); } }; this.scrollTop = function(val) { return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val); }; this.scrollLeft = function(val) { return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val); }; // derived by by Dan Pupius www.pupius.net BezierClass = function(st,ed,spd,p1,p2,p3,p4) { this.st = st; this.ed = ed; this.spd = spd; this.p1 = p1||0; this.p2 = p2||1; this.p3 = p3||0; this.p4 = p4||1; this.ts = (new Date()).getTime(); this.df = this.ed-this.st; }; BezierClass.prototype = { B2:function(t){ return 3*t*t*(1-t) }, B3:function(t){ return 3*t*(1-t)*(1-t) }, B4:function(t){ return (1-t)*(1-t)*(1-t) }, getNow:function(){ var nw = (new Date()).getTime(); var pc = 1-((nw-this.ts)/this.spd); var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); return (pc<0) ? this.ed : this.st+Math.round(this.df*bz); }, update:function(ed,spd){ this.st = this.getNow(); this.ed = ed; this.spd = spd; this.ts = (new Date()).getTime(); this.df = this.ed-this.st; return this; } }; if (this.ishwscroll) { // hw accelerated scroll this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"}; //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ //derived from http://stackoverflow.com/questions/11236090/ function getMatrixValues() { var tr = self.doc.css(cap.trstyle); if (tr&&(tr.substr(0,6)=="matrix")) { return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/); } return false; } this.getScrollTop = function(last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow(); } return self.doc.translate.y; }; this.getScrollLeft = function(last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow(); } return self.doc.translate.x; }; if (document.createEvent) { this.notifyScrollEvent = function(el) { var e = document.createEvent("UIEvents"); e.initUIEvent("scroll", false, true, window, 1); el.dispatchEvent(e); }; } else if (document.fireEvent) { this.notifyScrollEvent = function(el) { var e = document.createEventObject(); el.fireEvent("onscroll"); e.cancelBubble = true; }; } else { this.notifyScrollEvent = function(el,add) {}; //NOPE } if (cap.hastranslate3d&&self.opt.enabletranslate3d) { this.setScrollTop = function(val,silent) { self.doc.translate.y = val; self.doc.translate.ty = (val*-1)+"px"; self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); if (!silent) self.notifyScrollEvent(self.win[0]); }; this.setScrollLeft = function(val,silent) { self.doc.translate.x = val; self.doc.translate.tx = (val*-1)+"px"; self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); if (!silent) self.notifyScrollEvent(self.win[0]); }; } else { this.setScrollTop = function(val,silent) { self.doc.translate.y = val; self.doc.translate.ty = (val*-1)+"px"; self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); if (!silent) self.notifyScrollEvent(self.win[0]); }; this.setScrollLeft = function(val,silent) { self.doc.translate.x = val; self.doc.translate.tx = (val*-1)+"px"; self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); if (!silent) self.notifyScrollEvent(self.win[0]); }; } } else { // native scroll this.getScrollTop = function() { return self.docscroll.scrollTop(); }; this.setScrollTop = function(val) { return self.docscroll.scrollTop(val); }; this.getScrollLeft = function() { return self.docscroll.scrollLeft(); }; this.setScrollLeft = function(val) { return self.docscroll.scrollLeft(val); }; } this.getTarget = function(e) { if (!e) return false; if (e.target) return e.target; if (e.srcElement) return e.srcElement; return false; }; this.hasParent = function(e,id) { if (!e) return false; var el = e.target||e.srcElement||e||false; while (el && el.id != id) { el = el.parentNode||false; } return (el!==false); }; function getZIndex() { var dom = self.win; if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available while (dom.length>0) { if (dom[0].nodeType==9) return false; var zi = dom.css('zIndex'); if (!isNaN(zi)&&zi!=0) return parseInt(zi); dom = dom.parent(); } return false; }; //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie var _convertBorderWidth = {"thin":1,"medium":3,"thick":5}; function getWidthToPixel(dom,prop,chkheight) { var wd = dom.css(prop); var px = parseFloat(wd); if (isNaN(px)) { px = _convertBorderWidth[wd]||0; var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS if (self.isie8&&px) px+=1; return (brd) ? px : 0; } return px; }; this.getOffset = function() { if (self.isfixed) return {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))}; if (!self.viewport) return self.win.offset(); var ww = self.win.offset(); var vp = self.viewport.offset(); return {top:ww.top-vp.top+self.viewport.scrollTop(),left:ww.left-vp.left+self.viewport.scrollLeft()}; }; this.updateScrollBar = function(len) { if (self.ishwscroll) { self.rail.css({height:self.win.innerHeight()}); if (self.railh) self.railh.css({width:self.win.innerWidth()}); } else { var wpos = self.getOffset(); var pos = {top:wpos.top,left:wpos.left}; pos.top+= getWidthToPixel(self.win,'border-top-width',true); var brd = (self.win.outerWidth() - self.win.innerWidth())/2; pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width'); var off = self.opt.railoffset; if (off) { if (off.top) pos.top+=off.top; if (self.rail.align&&off.left) pos.left+=off.left; } if (!self.locked) self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()}); if (self.zoom) { self.zoom.css({top:pos.top+1,left:(self.rail.align==1) ? pos.left-20 : pos.left+self.rail.width+4}); } if (self.railh&&!self.locked) { var pos = {top:wpos.top,left:wpos.left}; var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true); var x = pos.left + getWidthToPixel(self.win,'border-left-width'); self.railh.css({top:y,left:x,width:self.railh.width}); } } }; this.doRailClick = function(e,dbl,hr) { var fn,pg,cur,pos; // if (self.rail.drag&&self.rail.drag.pt!=1) return; if (self.locked) return; // if (self.rail.drag) return; // self.cancelScroll(); self.cancelEvent(e); if (dbl) { fn = (hr) ? self.doScrollLeft : self.doScrollTop; cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth/2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight/2)) * self.scrollratio.y); fn(cur); } else { // console.log(e.pageY); fn = (hr) ? self.doScrollLeftBy : self.doScrollBy; cur = (hr) ? self.scroll.x : self.scroll.y; pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top; pg = (hr) ? self.view.w : self.view.h; (cur>=pos) ? fn(pg) : fn(-pg); } } self.hasanimationframe = (setAnimationFrame); self.hascancelanimationframe = (clearAnimationFrame); if (!self.hasanimationframe) { setAnimationFrame=function(fn){return setTimeout(fn,15-Math.floor((+new Date)/1000)%16)}; // 1000/60)}; clearAnimationFrame=clearInterval; } else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true}; this.init = function() { self.saved.css = []; if (cap.isie7mobile) return true; // SORRY, DO NOT WORK! if (cap.isoperamini) return true; // SORRY, DO NOT WORK! if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'}); self.zindex = "auto"; if (!self.ispage&&self.opt.zindex=="auto") { self.zindex = getZIndex()||"auto"; } else { self.zindex = self.opt.zindex; } if (!self.ispage&&self.zindex!="auto") { if (self.zindex>globalmaxzindex) globalmaxzindex=self.zindex; } if (self.isie&&self.zindex==0&&self.opt.zindex=="auto") { // fix IE auto == 0 self.zindex="auto"; } /* self.ispage = true; self.haswrapper = true; // self.win = $(window); self.docscroll = $("body"); // self.doc = $("body"); */ if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) { var cont = self.docscroll; if (self.ispage) cont = (self.haswrapper)?self.win:self.doc; if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'}); if (self.ispage&&cap.isie7) { if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue } if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"}); //force hw acceleration var cursor = $(document.createElement('div')); cursor.css({ position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px", 'background-color':self.opt.cursorcolor, border:self.opt.cursorborder, 'background-clip':'padding-box', '-webkit-border-radius':self.opt.cursorborderradius, '-moz-border-radius':self.opt.cursorborderradius, 'border-radius':self.opt.cursorborderradius }); cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight()); self.cursor = cursor; var rail = $(document.createElement('div')); rail.attr('id',self.id); rail.addClass('nicescroll-rails'); var v,a,kp = ["left","right"]; //"top","bottom" for(var n in kp) { a=kp[n]; v = self.opt.railpadding[a]; (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0; } rail.append(cursor); rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right']; rail.css({width:rail.width+"px",'zIndex':self.zindex,"background":self.opt.background,cursor:"default"}); rail.visibility = true; rail.scrollable = true; rail.align = (self.opt.railalign=="left") ? 0 : 1; self.rail = rail; self.rail.drag = false; var zoom = false; if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) { zoom = document.createElement('div'); self.bind(zoom,"click",self.doZoom); self.zoom = $(zoom); self.zoom.css({"cursor":"pointer",'z-index':self.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'}); if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom); if (cap.cantouch&&self.opt.gesturezoom) { self.ongesturezoom = function(e) { if (e.scale>1.5) self.doZoomIn(e); if (e.scale<0.8) self.doZoomOut(e); return self.cancelEvent(e); }; self.bind(self.win,"gestureend",self.ongesturezoom); } } // init HORIZ self.railh = false; if (self.opt.horizrailenabled) { self.css(cont,{'overflow-x':'hidden'}); var cursor = $(document.createElement('div')); cursor.css({ position:"relative",top:0,height:self.opt.cursorwidth,width:"0px", 'background-color':self.opt.cursorcolor, border:self.opt.cursorborder, 'background-clip':'padding-box', '-webkit-border-radius':self.opt.cursorborderradius, '-moz-border-radius':self.opt.cursorborderradius, 'border-radius':self.opt.cursorborderradius }); cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth()); self.cursorh = cursor; var railh = $(document.createElement('div')); railh.attr('id',self.id+'-hr'); railh.addClass('nicescroll-rails'); railh.height = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight()); railh.css({height:railh.height+"px",'zIndex':self.zindex,"background":self.opt.background}); railh.append(cursor); railh.visibility = true; railh.scrollable = true; railh.align = (self.opt.railvalign=="top") ? 0 : 1; self.railh = railh; self.railh.drag = false; } // if (self.ispage) { rail.css({position:"fixed",top:"0px",height:"100%"}); (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"}); self.body.append(rail); if (self.railh) { railh.css({position:"fixed",left:"0px",width:"100%"}); (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"}); self.body.append(railh); } } else { if (self.ishwscroll) { if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'}); var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; if (self.zoom) { self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4}); bd.append(self.zoom); } rail.css({position:"absolute",top:0}); (rail.align) ? rail.css({right:0}) : rail.css({left:0}); bd.append(rail); if (railh) { railh.css({position:"absolute",left:0,bottom:0}); (railh.align) ? railh.css({bottom:0}) : railh.css({top:0}); bd.append(railh); } } else { self.isfixed = (self.win.css("position")=="fixed"); var rlpos = (self.isfixed) ? "fixed" : "absolute"; if (!self.isfixed) self.viewport = self.getViewport(self.win[0]); if (self.viewport) { self.body = self.viewport; if ((/relative|absolute/.test(self.viewport.css("position")))==false) self.css(self.viewport,{"position":"relative"}); } rail.css({position:rlpos}); if (self.zoom) self.zoom.css({position:rlpos}); self.updateScrollBar(); self.body.append(rail); if (self.zoom) self.body.append(self.zoom); if (self.railh) { railh.css({position:rlpos}); self.body.append(railh); } } if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'}); // prevent grey layer on click if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true"); // IE, prevent dotted rectangle on focused div if (cap.iswebkit&&self.opt.disableoutline) self.win.css({"outline":"none"}); // if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera to test [TODO] } if (self.opt.autohidemode===false) { self.autohidedom = false; self.rail.css({opacity:self.opt.cursoropacitymax}); if (self.railh) self.railh.css({opacity:self.opt.cursoropacitymax}); } else if (self.opt.autohidemode===true) { self.autohidedom = $().add(self.rail); if (cap.isie8) self.autohidedom=self.autohidedom.add(self.cursor); if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); if (self.railh&&cap.isie8) self.autohidedom=self.autohidedom.add(self.cursorh); } else if (self.opt.autohidemode=="scroll") { self.autohidedom = $().add(self.rail); if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); } else if (self.opt.autohidemode=="cursor") { self.autohidedom = $().add(self.cursor); if (self.railh) self.autohidedom=self.autohidedom.add(self.cursorh); } else if (self.opt.autohidemode=="hidden") { self.autohidedom = false; self.hide(); self.locked = false; } if (cap.isie9mobile) { self.scrollmom = new ScrollMomentumClass2D(self); /* var trace = function(msg) { var db = $("#debug"); if (isNaN(msg)&&(typeof msg != "string")) { var x = []; for(var a in msg) { x.push(a+":"+msg[a]); } msg ="{"+x.join(",")+"}"; } if (db.children().length>0) { db.children().eq(0).before("<div>"+msg+"</div>"); } else { db.append("<div>"+msg+"</div>"); } } window.onerror = function(msg,url,ln) { trace("ERR: "+msg+" at "+ln); } */ self.onmangotouch = function(e) { var py = self.getScrollTop(); var px = self.getScrollLeft(); if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true; // $("#debug").html('DRAG:'+py); var dfy = py-self.mangotouch.sy; var dfx = px-self.mangotouch.sx; var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2))); if (df==0) return; var dry = (dfy<0)?-1:1; var drx = (dfx<0)?-1:1; var tm = +new Date(); if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy); if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) { // trace('RESET+'+(tm-self.mangotouch.tm)); self.scrollmom.stop(); self.scrollmom.reset(px,py); self.mangotouch.sy = py; self.mangotouch.ly = py; self.mangotouch.sx = px; self.mangotouch.lx = px; self.mangotouch.dry = dry; self.mangotouch.drx = drx; self.mangotouch.tm = tm; } else { self.scrollmom.stop(); self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy); var gap = tm - self.mangotouch.tm; self.mangotouch.tm = tm; // trace('MOVE:'+df+" - "+gap); var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px)); self.mangotouch.ly = py; self.mangotouch.lx = px; if (ds>2) { self.mangotouch.lazy = setTimeout(function(){ // trace('END:'+ds+'+'+gap); self.mangotouch.lazy = false; self.mangotouch.dry = 0; self.mangotouch.drx = 0; self.mangotouch.tm = 0; self.scrollmom.doMomentum(30); },100); } } } var top = self.getScrollTop(); var lef = self.getScrollLeft(); self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0}; self.bind(self.docscroll,"scroll",self.onmangotouch); } else { if (cap.cantouch||self.istouchcapable||self.opt.touchbehavior||cap.hasmstouch) { self.scrollmom = new ScrollMomentumClass2D(self); self.ontouchstart = function(e) { if (e.pointerType&&e.pointerType!=2) return false; if (!self.locked) { if (cap.hasmstouch) { var tg = (e.target) ? e.target : false; while (tg) { var nc = $(tg).getNiceScroll(); if ((nc.length>0)&&(nc[0].me == self.me)) break; if (nc.length>0) return false; if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break; tg = (tg.parentNode) ? tg.parentNode : false; } } self.cancelScroll(); var tg = self.getTarget(e); if (tg) { var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type)); if (skp) return self.stopPropagation(e); } if (!("clientX" in e) && ("changedTouches" in e)) { e.clientX = e.changedTouches[0].clientX; e.clientY = e.changedTouches[0].clientY; } if (self.forcescreen) { var le = e; var e = {"original":(e.original)?e.original:e}; e.clientX = le.screenX; e.clientY = le.screenY; } self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2,dl:false}; if (self.ispage||!self.opt.directionlockdeadzone) { self.rail.drag.dl = "f"; } else { var view = { w:$(window).width(), h:$(window).height() }; var page = { w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) } var maxh = Math.max(0,page.h - view.h); var maxw = Math.max(0,page.w - view.w); if (!self.rail.scrollable&&self.railh.scrollable) self.rail.drag.ck = (maxh>0) ? "v" : false; else if (self.rail.scrollable&&!self.railh.scrollable) self.rail.drag.ck = (maxw>0) ? "h" : false; else self.rail.drag.ck = false; if (!self.rail.drag.ck) self.rail.drag.dl = "f"; } if (self.opt.touchbehavior&&self.isiframe&&cap.isie) { var wp = self.win.position(); self.rail.drag.x+=wp.left; self.rail.drag.y+=wp.top; } self.hasmoving = false; self.lastmouseup = false; self.scrollmom.reset(e.clientX,e.clientY); if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) { var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false; if (!ip) { if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); // return self.cancelEvent(e); return (self.opt.touchbehavior) ? self.cancelEvent(e) : self.stopPropagation(e); } if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { pc = {"tg":tg,"click":false}; self.preventclick = pc; } } } }; self.ontouchend = function(e) { if (e.pointerType&&e.pointerType!=2) return false; if (self.rail.drag&&(self.rail.drag.pt==2)) { self.scrollmom.doMomentum(); self.rail.drag = false; if (self.hasmoving) { self.hasmoving = false; self.lastmouseup = true; self.hideCursor(); if (cap.hasmousecapture) document.releaseCapture(); if (!cap.cantouch) return self.cancelEvent(e); } } }; var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture); self.ontouchmove = function(e,byiframe) { if (e.pointerType&&e.pointerType!=2) return false; if (self.rail.drag&&(self.rail.drag.pt==2)) { if (cap.cantouch&&(typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements self.hasmoving = true; if (self.preventclick&&!self.preventclick.click) { self.preventclick.click = self.preventclick.tg.onclick||false; self.preventclick.tg.onclick = self.onpreventclick; } var ev = $.extend({"original":e},e); e = ev; if (("changedTouches" in e)) { e.clientX = e.changedTouches[0].clientX; e.clientY = e.changedTouches[0].clientY; } if (self.forcescreen) { var le = e; var e = {"original":(e.original)?e.original:e}; e.clientX = le.screenX; e.clientY = le.screenY; } var ofx = ofy = 0; if (moveneedoffset&&!byiframe) { var wp = self.win.position(); ofx=-wp.left; ofy=-wp.top; } var fy = e.clientY + ofy; var my = (fy-self.rail.drag.y); var fx = e.clientX + ofx; var mx = (fx-self.rail.drag.x); var ny = self.rail.drag.st-my; if (self.ishwscroll&&self.opt.bouncescroll) { if (ny<0) { ny = Math.round(ny/2); // fy = 0; } else if (ny>self.page.maxh) { ny = self.page.maxh+Math.round((ny-self.page.maxh)/2); // fy = 0; } } else { if (ny<0) {ny=0;fy=0} if (ny>self.page.maxh) {ny=self.page.maxh;fy=0} } if (self.railh&&self.railh.scrollable) { var nx = self.rail.drag.sl-mx; if (self.ishwscroll&&self.opt.bouncescroll) { if (nx<0) { nx = Math.round(nx/2); // fx = 0; } else if (nx>self.page.maxw) { nx = self.page.maxw+Math.round((nx-self.page.maxw)/2); // fx = 0; } } else { if (nx<0) {nx=0;fx=0} if (nx>self.page.maxw) {nx=self.page.maxw;fx=0} } } var grabbed = false; if (self.rail.drag.dl) { grabbed = true; if (self.rail.drag.dl=="v") nx = self.rail.drag.sl; else if (self.rail.drag.dl=="h") ny = self.rail.drag.st; } else { var ay = Math.abs(my); var ax = Math.abs(mx); var dz = self.opt.directionlockdeadzone; if (self.rail.drag.ck=="v") { if (ay>dz&&(ax<=(ay*0.3))) { self.rail.drag = false; return true; } else if (ax>dz) { self.rail.drag.dl="f"; $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked) } } else if (self.rail.drag.ck=="h") { if (ax>dz&&(ay<=(ax*0.3))) { self.rail.drag = false; return true; } else if (ay>dz) { self.rail.drag.dl="f"; $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked) } } } self.synched("touchmove",function(){ if (self.rail.drag&&(self.rail.drag.pt==2)) { if (self.prepareTransition) self.prepareTransition(0); if (self.rail.scrollable) self.setScrollTop(ny); self.scrollmom.update(fx,fy); if (self.railh&&self.railh.scrollable) { self.setScrollLeft(nx); self.showCursor(ny,nx); } else { self.showCursor(ny); } if (cap.isie10) document.selection.clear(); } }); if (cap.ischrome&&self.istouchcapable) grabbed=false; //chrome touch emulation doesn't like! if (grabbed) return self.cancelEvent(e); } }; } self.onmousedown = function(e,hronly) { if (self.rail.drag&&self.rail.drag.pt!=1) return; if (self.locked) return self.cancelEvent(e); self.cancelScroll(); self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)}; var tg = self.getTarget(e); if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); if (self.isiframe&&!cap.hasmousecapture) { self.saved["csspointerevents"] = self.doc.css("pointer-events"); self.css(self.doc,{"pointer-events":"none"}); } return self.cancelEvent(e); }; self.onmouseup = function(e) { if (self.rail.drag) { if (cap.hasmousecapture) document.releaseCapture(); if (self.isiframe&&!cap.hasmousecapture) self.doc.css("pointer-events",self.saved["csspointerevents"]); if(self.rail.drag.pt!=1)return; self.rail.drag = false; //if (!self.rail.active) self.hideCursor(); return self.cancelEvent(e); } }; self.onmousemove = function(e) { if (self.rail.drag) { if(self.rail.drag.pt!=1)return; if (cap.ischrome&&e.which==0) return self.onmouseup(e); self.cursorfreezed = true; if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x); if (self.scroll.x<0) self.scroll.x=0; var mw = self.scrollvaluemaxw; if (self.scroll.x>mw) self.scroll.x=mw; } else { self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y); if (self.scroll.y<0) self.scroll.y=0; var my = self.scrollvaluemax; if (self.scroll.y>my) self.scroll.y=my; } self.synched('mousemove',function(){ if (self.rail.drag&&(self.rail.drag.pt==1)) { self.showCursor(); if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x),self.opt.cursordragspeed); else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y),self.opt.cursordragspeed); } }); return self.cancelEvent(e); } /* else { self.checkarea = true; } */ }; if (cap.cantouch||self.opt.touchbehavior) { self.onpreventclick = function(e) { if (self.preventclick) { self.preventclick.tg.onclick = self.preventclick.click; self.preventclick = false; return self.cancelEvent(e); } } // self.onmousedown = self.ontouchstart; // self.onmouseup = self.ontouchend; // self.onmousemove = self.ontouchmove; self.bind(self.win,"mousedown",self.ontouchstart); // control content dragging self.onclick = (cap.isios) ? false : function(e) { if (self.lastmouseup) { self.lastmouseup = false; return self.cancelEvent(e); } else { return true; } }; if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) { self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue}); self.css(self.rail,{'cursor':cap.cursorgrabvalue}); } } else { function checkSelectionScroll(e) { if (!self.selectiondrag) return; if (e) { var ww = self.win.outerHeight(); var df = (e.pageY - self.selectiondrag.top); if (df>0&&df<ww) df=0; if (df>=ww) df-=ww; self.selectiondrag.df = df; } if (self.selectiondrag.df==0) return; var rt = -Math.floor(self.selectiondrag.df/6)*2; // self.doScrollTop(self.getScrollTop(true)+rt); self.doScrollBy(rt); self.debounced("doselectionscroll",function(){checkSelectionScroll()},50); } if ("getSelection" in document) { // A grade - Major browsers self.hasTextSelected = function() { return (document.getSelection().rangeCount>0); } } else if ("selection" in document) { //IE9- self.hasTextSelected = function() { return (document.selection.type != "None"); } } else { self.hasTextSelected = function() { // no support return false; } } self.onselectionstart = function(e) { if (self.ispage) return; self.selectiondrag = self.win.offset(); } self.onselectionend = function(e) { self.selectiondrag = false; } self.onselectiondrag = function(e) { if (!self.selectiondrag) return; if (self.hasTextSelected()) self.debounced("selectionscroll",function(){checkSelectionScroll(e)},250); } } if (cap.hasmstouch) { self.css(self.rail,{'-ms-touch-action':'none'}); self.css(self.cursor,{'-ms-touch-action':'none'}); self.bind(self.win,"MSPointerDown",self.ontouchstart); self.bind(document,"MSPointerUp",self.ontouchend); self.bind(document,"MSPointerMove",self.ontouchmove); self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault()}); self.bind(self.cursor,"contextmenu",function(e){e.preventDefault()}); } if (this.istouchcapable) { //desktop with screen touch enabled self.bind(self.win,"touchstart",self.ontouchstart); self.bind(document,"touchend",self.ontouchend); self.bind(document,"touchcancel",self.ontouchend); self.bind(document,"touchmove",self.ontouchmove); } self.bind(self.cursor,"mousedown",self.onmousedown); self.bind(self.cursor,"mouseup",self.onmouseup); if (self.railh) { self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)}); self.bind(self.cursorh,"mouseup",function(e){ if (self.rail.drag&&self.rail.drag.pt==2) return; self.rail.drag = false; self.hasmoving = false; self.hideCursor(); if (cap.hasmousecapture) document.releaseCapture(); return self.cancelEvent(e); }); } if (self.opt.cursordragontouch||!cap.cantouch&&!self.opt.touchbehavior) { self.rail.css({"cursor":"default"}); self.railh&&self.railh.css({"cursor":"default"}); self.jqbind(self.rail,"mouseenter",function() { if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.rail,"mouseleave",function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); if (self.opt.sensitiverail) { self.bind(self.rail,"click",function(e){self.doRailClick(e,false,false)}); self.bind(self.rail,"dblclick",function(e){self.doRailClick(e,true,false)}); self.bind(self.cursor,"click",function(e){self.cancelEvent(e)}); self.bind(self.cursor,"dblclick",function(e){self.cancelEvent(e)}); } if (self.railh) { self.jqbind(self.railh,"mouseenter",function() { if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.railh,"mouseleave",function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); if (self.opt.sensitiverail) { self.bind(self.railh, "click", function(e){self.doRailClick(e,false,true)}); self.bind(self.railh, "dblclick", function(e){self.doRailClick(e, true, true) }); self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e) }); self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e) }); } } } if (!cap.cantouch&&!self.opt.touchbehavior) { self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.onmouseup); self.bind(document,"mousemove",self.onmousemove); if (self.onclick) self.bind(document,"click",self.onclick); if (!self.ispage&&self.opt.enablescrollonselection) { self.bind(self.win[0],"mousedown",self.onselectionstart); self.bind(document,"mouseup",self.onselectionend); self.bind(self.cursor,"mouseup",self.onselectionend); if (self.cursorh) self.bind(self.cursorh,"mouseup",self.onselectionend); self.bind(document,"mousemove",self.onselectiondrag); } if (self.zoom) { self.jqbind(self.zoom,"mouseenter",function() { if (self.canshowonmouseevent) self.showCursor(); self.rail.active = true; }); self.jqbind(self.zoom,"mouseleave",function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor(); }); } } else { self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.ontouchend); self.bind(document,"mousemove",self.ontouchmove); if (self.onclick) self.bind(document,"click",self.onclick); if (self.opt.cursordragontouch) { self.bind(self.cursor,"mousedown",self.onmousedown); self.bind(self.cursor,"mousemove",self.onmousemove); self.cursorh&&self.bind(self.cursorh,"mousedown",self.onmousedown); self.cursorh&&self.bind(self.cursorh,"mousemove",self.onmousemove); } } if (self.opt.enablemousewheel) { if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.win /*self.docscroll*/ ,"mousewheel",self.onmousewheel); self.bind(self.rail,"mousewheel",self.onmousewheel); if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr); } if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) { if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++}); self.jqbind(self.win,"focus",function(e) { domfocus = (self.getTarget(e)).id||true; self.hasfocus = true; if (self.canshowonmouseevent) self.noticeCursor(); }); self.jqbind(self.win,"blur",function(e) { domfocus = false; self.hasfocus = false; }); self.jqbind(self.win,"mouseenter",function(e) { mousefocus = (self.getTarget(e)).id||true; self.hasmousefocus = true; if (self.canshowonmouseevent) self.noticeCursor(); }); self.jqbind(self.win,"mouseleave",function() { mousefocus = false; self.hasmousefocus = false; }); }; } // !ie9mobile //Thanks to http://www.quirksmode.org !! self.onkeypress = function(e) { if (self.locked&&self.page.maxh==0) return true; e = (e) ? e : window.e; var tg = self.getTarget(e); if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { var tp = tg.getAttribute('type')||tg.type||false; if ((!tp)||!(/submit|button|cancel/i.tp)) return true; } if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) { var key = e.keyCode; if (self.locked&&key!=27) return self.cancelEvent(e); var ctrl = e.ctrlKey||false; var shift = e.shiftKey || false; var ret = false; switch (key) { case 38: case 63233: //safari self.doScrollBy(24*3); ret = true; break; case 40: case 63235: //safari self.doScrollBy(-24*3); ret = true; break; case 37: case 63232: //safari if (self.railh) { (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3); ret = true; } break; case 39: case 63234: //safari if (self.railh) { (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3); ret = true; } break; case 33: case 63276: // safari self.doScrollBy(self.view.h); ret = true; break; case 34: case 63277: // safari self.doScrollBy(-self.view.h); ret = true; break; case 36: case 63273: // safari (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0); ret = true; break; case 35: case 63275: // safari (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh); ret = true; break; case 32: if (self.opt.spacebarenabled) { (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h); ret = true; } break; case 27: // ESC if (self.zoomactive) { self.doZoom(); ret = true; } break; } if (ret) return self.cancelEvent(e); } }; if (self.opt.enablekeyboard) self.bind(document,(cap.isopera&&!cap.isopera12)?"keypress":"keydown",self.onkeypress); self.bind(window,'resize',self.lazyResize); self.bind(window,'orientationchange',self.lazyResize); self.bind(window,"load",self.lazyResize); if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug - it persists in version 26 var tmp=self.win.attr("style"); var ww = parseFloat(self.win.css("width"))+1; self.win.css('width',ww); self.synched("chromefix",function(){self.win.attr("style",tmp)}); } // Trying a cross-browser implementation - good luck! self.onAttributeChange = function(e) { self.lazyResize(250); } if (!self.ispage&&!self.haswrapper) { // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content if (clsMutationObserver !== false) { self.observer = new clsMutationObserver(function(mutations) { mutations.forEach(self.onAttributeChange); }); self.observer.observe(self.win[0],{childList: true, characterData: false, attributes: true, subtree: false}); self.observerremover = new clsMutationObserver(function(mutations) { mutations.forEach(function(mo){ if (mo.removedNodes.length>0) { for (var dd in mo.removedNodes) { if (mo.removedNodes[dd]==self.win[0]) return self.remove(); } } }); }); self.observerremover.observe(self.win[0].parentNode,{childList: true, characterData: false, attributes: false, subtree: false}); } else { self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange); if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug self.bind(self.win,"DOMNodeRemoved",function(e){ if (e.target==self.win[0]) self.remove(); }); } } // if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom); if (self.istextarea) self.bind(self.win,"mouseup",self.lazyResize); self.checkrtlmode = true; self.lazyResize(30); } if (this.doc[0].nodeName == 'IFRAME') { function oniframeload(e) { self.iframexd = false; try { var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document; var a = doc.domain; } catch(e){self.iframexd = true;doc=false}; if (self.iframexd) { if ("console" in window) console.log('NiceScroll error: policy restriced iframe'); return true; //cross-domain - I can't manage this } self.forcescreen = true; if (self.isiframe) { self.iframe = { "doc":$(doc), "html":self.doc.contents().find('html')[0], "body":self.doc.contents().find('body')[0] }; self.getContentSize = function(){ return { w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth), h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight) } } self.docscroll = $(self.iframe.body);//$(this.contentWindow); } if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) { self.win.scrollTop(0); // reset position self.doc.height(""); //reset height to fix browser bug var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight); self.doc.height(hh); } self.lazyResize(30); if (cap.isie7) self.css($(self.iframe.html),{'overflow-y':'hidden'}); //self.css($(doc.body),{'overflow-y':'hidden'}); self.css($(self.iframe.body),{'overflow-y':'hidden'}); if (cap.isios&&self.haswrapper) { self.css($(doc.body),{'-webkit-transform':'translate3d(0,0,0)'}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/ console.log(1); } if ('contentWindow' in this) { self.bind(this.contentWindow,"scroll",self.onscroll); //IE8 & minor } else { self.bind(doc,"scroll",self.onscroll); } if (self.opt.enablemousewheel) { self.bind(doc,"mousewheel",self.onmousewheel); } if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress); if (cap.cantouch||self.opt.touchbehavior) { self.bind(doc,"mousedown",self.ontouchstart); self.bind(doc,"mousemove",function(e){self.ontouchmove(e,true)}); if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue}); } self.bind(doc,"mouseup",self.ontouchend); if (self.zoom) { if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom); if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom); } }; if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){ setTimeout(function(){oniframeload.call(self.doc[0],false)},500); } self.bind(this.doc,"load",oniframeload); } }; this.showCursor = function(py,px) { if (self.cursortimeout) { clearTimeout(self.cursortimeout); self.cursortimeout = 0; } if (!self.rail) return; if (self.autohidedom) { self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax}); self.cursoractive = true; } if (!self.rail.drag||self.rail.drag.pt!=1) { if ((typeof py != "undefined")&&(py!==false)) { self.scroll.y = Math.round(py * 1/self.scrollratio.y); } if (typeof px != "undefined") { self.scroll.x = Math.round(px * 1/self.scrollratio.x); } } self.cursor.css({height:self.cursorheight,top:self.scroll.y}); if (self.cursorh) { (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x}); self.cursoractive = true; } if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax}); }; this.hideCursor = function(tm) { if (self.cursortimeout) return; if (!self.rail) return; if (!self.autohidedom) return; self.cursortimeout = setTimeout(function() { if (!self.rail.active||!self.showonmouseevent) { self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin}); if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin}); self.cursoractive = false; } self.cursortimeout = 0; },tm||self.opt.hidecursordelay); }; this.noticeCursor = function(tm,py,px) { self.showCursor(py,px); if (!self.rail.active) self.hideCursor(tm); }; this.getContentSize = (self.ispage) ? function(){ return { w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) } } : (self.haswrapper) ? function(){ return { w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')), h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom')) } } : function() { return { w:self.docscroll[0].scrollWidth, h:self.docscroll[0].scrollHeight } }; this.onResize = function(e,page) { if (!self.win) return false; if (!self.haswrapper&&!self.ispage) { if (self.win.css('display')=='none') { if (self.visibility) self.hideRail().hideRailHr(); return false; } else { if (!self.hidden&&!self.visibility) self.showRail().showRailHr(); } } var premaxh = self.page.maxh; var premaxw = self.page.maxw; var preview = {h:self.view.h,w:self.view.w}; self.view = { w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth), h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight) }; self.page = (page) ? page : self.getContentSize(); self.page.maxh = Math.max(0,self.page.h - self.view.h); self.page.maxw = Math.max(0,self.page.w - self.view.w); if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) { // test position if (!self.ispage) { var pos = self.win.offset(); if (self.lastposition) { var lst = self.lastposition; if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do } self.lastposition = pos; } else { return self; //nothing to do } } if (self.page.maxh==0) { self.hideRail(); self.scrollvaluemax = 0; self.scroll.y = 0; self.scrollratio.y = 0; self.cursorheight = 0; self.setScrollTop(0); self.rail.scrollable = false; } else { self.rail.scrollable = true; } if (self.page.maxw==0) { self.hideRailHr(); self.scrollvaluemaxw = 0; self.scroll.x = 0; self.scrollratio.x = 0; self.cursorwidth = 0; self.setScrollLeft(0); self.railh.scrollable = false; } else { self.railh.scrollable = true; } self.locked = (self.page.maxh==0)&&(self.page.maxw==0); if (self.locked) { if (!self.ispage) self.updateScrollBar(self.view); return false; } if (!self.hidden&&!self.visibility) { self.showRail().showRailHr(); } else if (!self.hidden&&!self.railh.visibility) self.showRailHr(); if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20; self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h))); self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorheight); self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w))); self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorwidth); self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder; if (self.railh) { self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w; self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder; } if (self.checkrtlmode&&self.railh) { self.checkrtlmode = false; if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw); } if (!self.ispage) self.updateScrollBar(self.view); self.scrollratio = { x:(self.page.maxw/self.scrollvaluemaxw), y:(self.page.maxh/self.scrollvaluemax) }; var sy = self.getScrollTop(); if (sy>self.page.maxh) { self.doScrollTop(self.page.maxh); } else { self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); if (self.cursoractive) self.noticeCursor(); } if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y)); return self; }; this.resize = self.onResize; this.lazyResize = function(tm) { // event debounce tm = (isNaN(tm)) ? 30 : tm; self.delayed('resize',self.resize,tm); return self; } // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel function _modernWheelEvent(dom,name,fn,bubble) { self._bind(dom,name,function(e){ var e = (e) ? e : window.event; var event = { original: e, target: e.target || e.srcElement, type: "wheel", deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, deltaX: 0, deltaZ: 0, preventDefault: function() { e.preventDefault ? e.preventDefault() : e.returnValue = false; return false; }, stopImmediatePropagation: function() { (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true; } }; if (name=="mousewheel") { event.deltaY = - 1/40 * e.wheelDelta; e.wheelDeltaX && (event.deltaX = - 1/40 * e.wheelDeltaX); } else { event.deltaY = e.detail; } return fn.call(dom,event); },bubble); }; this._bind = function(el,name,fn,bubble) { // primitive bind self.events.push({e:el,n:name,f:fn,b:bubble,q:false}); if (el.addEventListener) { el.addEventListener(name,fn,bubble||false); } else if (el.attachEvent) { el.attachEvent("on"+name,fn); } else { el["on"+name] = fn; } }; this.jqbind = function(dom,name,fn) { // use jquery bind for non-native events (mouseenter/mouseleave) self.events.push({e:dom,n:name,f:fn,q:true}); $(dom).bind(name,fn); } this.bind = function(dom,name,fn,bubble) { // touch-oriented & fixing jquery bind var el = ("jquery" in dom) ? dom[0] : dom; if (name=='mousewheel') { if ("onwheel" in self.win) { self._bind(el,"wheel",fn,bubble||false); } else { var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox _modernWheelEvent(el,wname,fn,bubble||false); if (wname=="DOMMouseScroll") _modernWheelEvent(el,"MozMousePixelScroll",fn,bubble||false); // Firefox legacy } } else if (el.addEventListener) { if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove'; self._bind(el,tt,function(e){ if (e.touches) { if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);} } else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);} //blackberry },bubble||false); } self._bind(el,name,fn,bubble||false); if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false); } else { self._bind(el,name,function(e) { e = e||window.event||false; if (e) { if (e.srcElement) e.target=e.srcElement; } if (!("pageY" in e)) { e.pageX = e.clientX + document.documentElement.scrollLeft; e.pageY = e.clientY + document.documentElement.scrollTop; } return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true; }); } }; this._unbind = function(el,name,fn,bub) { // primitive unbind if (el.removeEventListener) { el.removeEventListener(name,fn,bub); } else if (el.detachEvent) { el.detachEvent('on'+name,fn); } else { el['on'+name] = false; } }; this.unbindAll = function() { for(var a=0;a<self.events.length;a++) { var r = self.events[a]; (r.q) ? r.e.unbind(r.n,r.f) : self._unbind(r.e,r.n,r.f,r.b); } }; // Thanks to http://www.switchonthecode.com !! this.cancelEvent = function(e) { var e = (e.original) ? e.original : (e) ? e : window.event||false; if (!e) return false; if(e.preventDefault) e.preventDefault(); if(e.stopPropagation) e.stopPropagation(); if(e.preventManipulation) e.preventManipulation(); //IE10 e.cancelBubble = true; e.cancel = true; e.returnValue = false; return false; }; this.stopPropagation = function(e) { var e = (e.original) ? e.original : (e) ? e : window.event||false; if (!e) return false; if (e.stopPropagation) return e.stopPropagation(); if (e.cancelBubble) e.cancelBubble=true; return false; } this.showRail = function() { if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) { self.visibility = true; self.rail.visibility = true; self.rail.css('display','block'); } return self; }; this.showRailHr = function() { if (!self.railh) return self; if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) { self.railh.visibility = true; self.railh.css('display','block'); } return self; }; this.hideRail = function() { self.visibility = false; self.rail.visibility = false; self.rail.css('display','none'); return self; }; this.hideRailHr = function() { if (!self.railh) return self; self.railh.visibility = false; self.railh.css('display','none'); return self; }; this.show = function() { self.hidden = false; self.locked = false; return self.showRail().showRailHr(); }; this.hide = function() { self.hidden = true; self.locked = true; return self.hideRail().hideRailHr(); }; this.toggle = function() { return (self.hidden) ? self.show() : self.hide(); }; this.remove = function() { self.stop(); if (self.cursortimeout) clearTimeout(self.cursortimeout); self.doZoomOut(); self.unbindAll(); if (cap.isie9) self.win[0].detachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug if (self.observer !== false) self.observer.disconnect(); if (self.observerremover !== false) self.observerremover.disconnect(); self.events = null; if (self.cursor) { self.cursor.remove(); } if (self.cursorh) { self.cursorh.remove(); } if (self.rail) { self.rail.remove(); } if (self.railh) { self.railh.remove(); } if (self.zoom) { self.zoom.remove(); } for(var a=0;a<self.saved.css.length;a++) { var d=self.saved.css[a]; d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]); } self.saved = false; self.me.data('__nicescroll',''); //erase all traces // memory leak fixed by GianlucaGuarini - thanks a lot! // remove the current nicescroll from the $.nicescroll array & normalize array var lst = $.nicescroll; lst.each(function(i){ if (!this) return; if(this.id === self.id) { delete lst[i]; for(var b=++i;b<lst.length;b++,i++) lst[i]=lst[b]; lst.length--; if (lst.length) delete lst[lst.length]; } }); for (var i in self) { self[i] = null; delete self[i]; } self = null; }; this.scrollstart = function(fn) { this.onscrollstart = fn; return self; } this.scrollend = function(fn) { this.onscrollend = fn; return self; } this.scrollcancel = function(fn) { this.onscrollcancel = fn; return self; } this.zoomin = function(fn) { this.onzoomin = fn; return self; } this.zoomout = function(fn) { this.onzoomout = fn; return self; } this.isScrollable = function(e) { var dom = (e.target) ? e.target : e; if (dom.nodeName == 'OPTION') return true; while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { var dd = $(dom); var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight); dom = (dom.parentNode) ? dom.parentNode : false; } return false; }; this.getViewport = function(me) { var dom = (me&&me.parentNode) ? me.parentNode : false; while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { var dd = $(dom); var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; if ((/scroll|auto/.test(ov))&&(dom.clientHeight!=dom.scrollHeight)) return dd; if (dd.getNiceScroll().length>0) return dd; dom = (dom.parentNode) ? dom.parentNode : false; } return false; }; function execScrollWheel(e,hr,chkscroll) { var px,py; var rt = 1; if (e.deltaMode==0) { // PIXEL px = -Math.floor(e.deltaX*(self.opt.mousescrollstep/(18*3))); py = -Math.floor(e.deltaY*(self.opt.mousescrollstep/(18*3))); } else if (e.deltaMode==1) { // LINE px = -Math.floor(e.deltaX*self.opt.mousescrollstep); py = -Math.floor(e.deltaY*self.opt.mousescrollstep); } if (hr&&self.opt.oneaxismousemode&&(px==0)&&py) { // classic vertical-only mousewheel + browser with x/y support px = py; py = 0; } if (px) { if (self.scrollmom) {self.scrollmom.stop()} self.lastdeltax+=px; self.debounced("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}},120); } if (py) { if (self.opt.nativeparentscrolling&&chkscroll&&!self.ispage&&!self.zoomactive) { if (py<0) { if (self.getScrollTop()>=self.page.maxh) return true; } else { if (self.getScrollTop()<=0) return true; } } if (self.scrollmom) {self.scrollmom.stop()} self.lastdeltay+=py; self.debounced("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}},120); } e.stopImmediatePropagation(); return e.preventDefault(); // return self.cancelEvent(e); }; this.onmousewheel = function(e) { if (self.locked) { self.debounced("checkunlock",self.resize,250); return true; } if (self.rail.drag) return self.cancelEvent(e); if (self.opt.oneaxismousemode=="auto"&&e.deltaX!=0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant) if (self.opt.oneaxismousemode&&e.deltaX==0) { if (!self.rail.scrollable) { if (self.railh&&self.railh.scrollable) { return self.onmousewheelhr(e); } else { return true; } } } var nw = +(new Date()); var chk = false; if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { // self.checkarea = false; self.nativescrollingarea = self.isScrollable(e); chk = true; } self.checkarea = nw; if (self.nativescrollingarea) return true; // this isn't my business // if (self.locked) return self.cancelEvent(e); var ret = execScrollWheel(e,false,chk); if (ret) self.checkarea = 0; return ret; }; this.onmousewheelhr = function(e) { if (self.locked||!self.railh.scrollable) return true; if (self.rail.drag) return self.cancelEvent(e); var nw = +(new Date()); var chk = false; if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { // self.checkarea = false; self.nativescrollingarea = self.isScrollable(e); chk = true; } self.checkarea = nw; if (self.nativescrollingarea) return true; // this isn't my business if (self.locked) return self.cancelEvent(e); return execScrollWheel(e,true,chk); }; this.stop = function() { self.cancelScroll(); if (self.scrollmon) self.scrollmon.stop(); self.cursorfreezed = false; self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); self.noticeCursor(); return self; }; this.getTransitionSpeed = function(dif) { var sp = Math.round(self.opt.scrollspeed*10); var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed)); return (ex>20) ? ex : 0; } if (!self.opt.smoothscroll) { this.doScrollLeft = function(x,spd) { //direct var y = self.getScrollTop(); self.doScrollPos(x,y,spd); } this.doScrollTop = function(y,spd) { //direct var x = self.getScrollLeft(); self.doScrollPos(x,y,spd); } this.doScrollPos = function(x,y,spd) { //direct var nx = (x>self.page.maxw) ? self.page.maxw : x; if (nx<0) nx=0; var ny = (y>self.page.maxh) ? self.page.maxh : y; if (ny<0) ny=0; self.synched('scroll',function(){ self.setScrollTop(ny); self.setScrollLeft(nx); }); } this.cancelScroll = function() {}; // direct } else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) { this.prepareTransition = function(dif,istime) { var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif); var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : ''; if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) { self.lasttransitionstyle = trans; self.doc.css(cap.transitionstyle,trans); } return ex; }; this.doScrollLeft = function(x,spd) { //trans var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); self.doScrollPos(x,y,spd); } this.doScrollTop = function(y,spd) { //trans var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); self.doScrollPos(x,y,spd); } this.doScrollPos = function(x,y,spd) { //trans var py = self.getScrollTop(); var px = self.getScrollLeft(); if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection if (self.opt.bouncescroll==false) { if (y<0) y=0; else if (y>self.page.maxh) y=self.page.maxh; if (x<0) x=0; else if (x>self.page.maxw) x=self.page.maxw; } if (self.scrollrunning&&x==self.newscrollx&&y==self.newscrolly) return false; self.newscrolly = y; self.newscrollx = x; self.newscrollspeed = spd||false; if (self.timer) return false; self.timer = setTimeout(function(){ var top = self.getScrollTop(); var lft = self.getScrollLeft(); var dst = {}; dst.x = x-lft; dst.y = y-top; dst.px = lft; dst.py = top; var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2))); // var df = (self.newscrollspeed) ? self.newscrollspeed : dd; var ms = (self.newscrollspeed && self.newscrollspeed>1) ? self.newscrollspeed : self.getTransitionSpeed(dd); if (self.newscrollspeed&&self.newscrollspeed<=1) ms*=self.newscrollspeed; self.prepareTransition(ms,true); if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); if (ms>0) { if (!self.scrollrunning&&self.onscrollstart) { var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; self.onscrollstart.call(self,info); } if (cap.transitionend) { if (!self.scrollendtrapped) { self.scrollendtrapped = true; self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!! } } else { if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); self.scrollendtrapped = setTimeout(self.onScrollEnd,ms); // simulate transitionend event } var py = top; var px = lft; self.timerscroll = { bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1), bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1) }; if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60); } self.synched("doScroll-set",function(){ self.timer = 0; if (self.scrollendtrapped) self.scrollrunning = true; self.setScrollTop(self.newscrolly); self.setScrollLeft(self.newscrollx); if (!self.scrollendtrapped) self.onScrollEnd(); }); },50); }; this.cancelScroll = function() { if (!self.scrollendtrapped) return true; var py = self.getScrollTop(); var px = self.getScrollLeft(); self.scrollrunning = false; if (!cap.transitionend) clearTimeout(cap.transitionend); self.scrollendtrapped = false; self._unbind(self.doc,cap.transitionend,self.onScrollEnd); self.prepareTransition(0); self.setScrollTop(py); // fire event onscroll if (self.railh) self.setScrollLeft(px); if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); self.timerscroll = false; self.cursorfreezed = false; //self.noticeCursor(false,py,px); self.showCursor(py,px); return self; }; this.onScrollEnd = function() { if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd); self.scrollendtrapped = false; self.prepareTransition(0); if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); self.timerscroll = false; var py = self.getScrollTop(); var px = self.getScrollLeft(); self.setScrollTop(py); // fire event onscroll if (self.railh) self.setScrollLeft(px); // fire event onscroll left self.noticeCursor(false,py,px); self.cursorfreezed = false; if (py<0) py=0 else if (py>self.page.maxh) py=self.page.maxh; if (px<0) px=0 else if (px>self.page.maxw) px=self.page.maxw; if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed); if (self.onscrollend&&self.scrollrunning) { var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}}; self.onscrollend.call(self,info); } self.scrollrunning = false; }; } else { this.doScrollLeft = function(x,spd) { //no-trans var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); self.doScrollPos(x,y,spd); } this.doScrollTop = function(y,spd) { //no-trans var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); self.doScrollPos(x,y,spd); } this.doScrollPos = function(x,y,spd) { //no-trans var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y; if ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true; if (self.timer) clearAnimationFrame(self.timer); self.timer = 0; var py = self.getScrollTop(); var px = self.getScrollLeft(); if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection self.newscrolly = y; self.newscrollx = x; if (!self.bouncescroll||!self.rail.visibility) { if (self.newscrolly<0) { self.newscrolly = 0; } else if (self.newscrolly>self.page.maxh) { self.newscrolly = self.page.maxh; } } if (!self.bouncescroll||!self.railh.visibility) { if (self.newscrollx<0) { self.newscrollx = 0; } else if (self.newscrollx>self.page.maxw) { self.newscrollx = self.page.maxw; } } self.dst = {}; self.dst.x = x-px; self.dst.y = y-py; self.dst.px = px; self.dst.py = py; var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2))); self.dst.ax = self.dst.x / dst; self.dst.ay = self.dst.y / dst; var pa = 0; var pe = dst; if (self.dst.x==0) { pa = py; pe = y; self.dst.ay = 1; self.dst.py = 0; } else if (self.dst.y==0) { pa = px; pe = x; self.dst.ax = 1; self.dst.px = 0; } var ms = self.getTransitionSpeed(dst); if (spd&&spd<=1) ms*=spd; if (ms>0) { self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1); } else { self.bzscroll = false; } if (self.timer) return; if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize(); var sync = 1; function scrolling() { if (self.cancelAnimationFrame) return true; self.scrollrunning = true; sync = 1-sync; if (sync) return (self.timer = setAnimationFrame(scrolling)||1); var done = 0; var sc = sy = self.getScrollTop(); if (self.dst.ay) { sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()*self.dst.ay) : self.newscrolly; var dr=sc-sy; if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly; self.setScrollTop(sc); if (sc == self.newscrolly) done=1; } else { done=1; } var scx = sx = self.getScrollLeft(); if (self.dst.ax) { scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx; var dr=scx-sx; if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx; self.setScrollLeft(scx); if (scx == self.newscrollx) done+=1; } else { done+=1; } if (done==2) { self.timer = 0; self.cursorfreezed = false; self.bzscroll = false; self.scrollrunning = false; if (sc<0) sc=0; else if (sc>self.page.maxh) sc=self.page.maxh; if (scx<0) scx=0; else if (scx>self.page.maxw) scx=self.page.maxw; if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc); else { if (self.onscrollend) { var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}}; self.onscrollend.call(self,info); } } } else { self.timer = setAnimationFrame(scrolling)||1; } }; self.cancelAnimationFrame=false; self.timer = 1; if (self.onscrollstart&&!self.scrollrunning) { var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; self.onscrollstart.call(self,info); } scrolling(); if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize(); self.noticeCursor(); }; this.cancelScroll = function() { if (self.timer) clearAnimationFrame(self.timer); self.timer = 0; self.bzscroll = false; self.scrollrunning = false; return self; }; } this.doScrollBy = function(stp,relative) { var ny = 0; if (relative) { ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y) } else { var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true); ny = sy-stp; } if (self.bouncescroll) { var haf = Math.round(self.view.h/2); if (ny<-haf) ny=-haf else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf); } self.cursorfreezed = false; py = self.getScrollTop(true); if (ny<0&&py<=0) return self.noticeCursor(); else if (ny>self.page.maxh&&py>=self.page.maxh) { self.checkContentSize(); return self.noticeCursor(); } self.doScrollTop(ny); }; this.doScrollLeftBy = function(stp,relative) { var nx = 0; if (relative) { nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x) } else { var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true); nx = sx-stp; } if (self.bouncescroll) { var haf = Math.round(self.view.w/2); if (nx<-haf) nx=-haf else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf); } self.cursorfreezed = false; px = self.getScrollLeft(true); if (nx<0&&px<=0) return self.noticeCursor(); else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor(); self.doScrollLeft(nx); }; this.doScrollTo = function(pos,relative) { var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos; if (ny<0) ny=0 else if (ny>self.page.maxh) ny = self.page.maxh; self.cursorfreezed = false; self.doScrollTop(pos); }; this.checkContentSize = function() { var pg = self.getContentSize(); if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg); }; self.onscroll = function(e) { if (self.rail.drag) return; if (!self.cursorfreezed) { self.synched('scroll',function(){ self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); self.noticeCursor(); }); } }; self.bind(self.docscroll,"scroll",self.onscroll); this.doZoomIn = function(e) { if (self.zoomactive) return; self.zoomactive = true; self.zoomrestore = { style:{} }; var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight']; var win = self.win[0].style; for(var a in lst) { var pp = lst[a]; self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : ''; } self.zoomrestore.style.width = self.win.css('width'); self.zoomrestore.style.height = self.win.css('height'); self.zoomrestore.padding = { w:self.win.outerWidth()-self.win.width(), h:self.win.outerHeight()-self.win.height() }; if (cap.isios4) { self.zoomrestore.scrollTop = $(window).scrollTop(); $(window).scrollTop(0); } self.win.css({ "position":(cap.isios4)?"absolute":"fixed", "top":0, "left":0, "z-index":globalmaxzindex+100, "margin":"0px" }); var bkg = self.win.css("backgroundColor"); if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff"); self.rail.css({"z-index":globalmaxzindex+101}); self.zoom.css({"z-index":globalmaxzindex+102}); self.zoom.css('backgroundPosition','0px -18px'); self.resizeZoom(); if (self.onzoomin) self.onzoomin.call(self); return self.cancelEvent(e); }; this.doZoomOut = function(e) { if (!self.zoomactive) return; self.zoomactive = false; self.win.css("margin",""); self.win.css(self.zoomrestore.style); if (cap.isios4) { $(window).scrollTop(self.zoomrestore.scrollTop); } self.rail.css({"z-index":self.zindex}); self.zoom.css({"z-index":self.zindex}); self.zoomrestore = false; self.zoom.css('backgroundPosition','0px 0px'); self.onResize(); if (self.onzoomout) self.onzoomout.call(self); return self.cancelEvent(e); }; this.doZoom = function(e) { return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); }; this.resizeZoom = function() { if (!self.zoomactive) return; var py = self.getScrollTop(); //preserve scrolling position self.win.css({ width:$(window).width()-self.zoomrestore.padding.w+"px", height:$(window).height()-self.zoomrestore.padding.h+"px" }); self.onResize(); self.setScrollTop(Math.min(self.page.maxh,py)); }; this.init(); $.nicescroll.push(this); }; // Inspired by the work of Kin Blas // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js var ScrollMomentumClass2D = function(nc) { var self = this; this.nc = nc; this.lastx = 0; this.lasty = 0; this.speedx = 0; this.speedy = 0; this.lasttime = 0; this.steptime = 0; this.snapx = false; this.snapy = false; this.demulx = 0; this.demuly = 0; this.lastscrollx = -1; this.lastscrolly = -1; this.chkx = 0; this.chky = 0; this.timer = 0; this.time = function() { return +new Date();//beautifull hack }; this.reset = function(px,py) { self.stop(); var now = self.time(); self.steptime = 0; self.lasttime = now; self.speedx = 0; self.speedy = 0; self.lastx = px; self.lasty = py; self.lastscrollx = -1; self.lastscrolly = -1; }; this.update = function(px,py) { var now = self.time(); self.steptime = now - self.lasttime; self.lasttime = now; var dy = py - self.lasty; var dx = px - self.lastx; var sy = self.nc.getScrollTop(); var sx = self.nc.getScrollLeft(); var newy = sy + dy; var newx = sx + dx; self.snapx = (newx<0)||(newx>self.nc.page.maxw); self.snapy = (newy<0)||(newy>self.nc.page.maxh); self.speedx = dx; self.speedy = dy; self.lastx = px; self.lasty = py; }; this.stop = function() { self.nc.unsynched("domomentum2d"); if (self.timer) clearTimeout(self.timer); self.timer = 0; self.lastscrollx = -1; self.lastscrolly = -1; }; this.doSnapy = function(nx,ny) { var snap = false; if (ny<0) { ny=0; snap=true; } else if (ny>self.nc.page.maxh) { ny=self.nc.page.maxh; snap=true; } if (nx<0) { nx=0; snap=true; } else if (nx>self.nc.page.maxw) { nx=self.nc.page.maxw; snap=true; } if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed); }; this.doMomentum = function(gp) { var t = self.time(); var l = (gp) ? t+gp : self.lasttime; var sl = self.nc.getScrollLeft(); var st = self.nc.getScrollTop(); var pageh = self.nc.page.maxh; var pagew = self.nc.page.maxw; self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0; self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0; var chk = l && (t - l) <= 60; if ((st<0)||(st>pageh)||(sl<0)||(sl>pagew)) chk = false; var sy = (self.speedy && chk) ? self.speedy : false; var sx = (self.speedx && chk) ? self.speedx : false; if (sy||sx) { var tm = Math.max(16,self.steptime); //timeout granularity if (tm>50) { // do smooth var xm = tm/50; self.speedx*=xm; self.speedy*=xm; tm = 50; } self.demulxy = 0; self.lastscrollx = self.nc.getScrollLeft(); self.chkx = self.lastscrollx; self.lastscrolly = self.nc.getScrollTop(); self.chky = self.lastscrolly; var nx = self.lastscrollx; var ny = self.lastscrolly; var onscroll = function(){ var df = ((self.time()-t)>600) ? 0.04 : 0.02; if (self.speedx) { nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy))); self.lastscrollx = nx; if ((nx<0)||(nx>pagew)) df=0.10; } if (self.speedy) { ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy))); self.lastscrolly = ny; if ((ny<0)||(ny>pageh)) df=0.10; } self.demulxy = Math.min(1,self.demulxy+df); self.nc.synched("domomentum2d",function(){ if (self.speedx) { var scx = self.nc.getScrollLeft(); if (scx!=self.chkx) self.stop(); self.chkx=nx; self.nc.setScrollLeft(nx); } if (self.speedy) { var scy = self.nc.getScrollTop(); if (scy!=self.chky) self.stop(); self.chky=ny; self.nc.setScrollTop(ny); } if(!self.timer) { self.nc.hideCursor(); self.doSnapy(nx,ny); } }); if (self.demulxy<1) { self.timer = setTimeout(onscroll,tm); } else { self.stop(); self.nc.hideCursor(); self.doSnapy(nx,ny); } }; onscroll(); } else { self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop()); } } }; // override jQuery scrollTop var _scrollTop = jQuery.fn.scrollTop; // preserve original function jQuery.cssHooks["pageYOffset"] = { get: function(elem,computed,extra) { var nice = $.data(elem,'__nicescroll')||false; return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); }, set: function(elem,value) { var nice = $.data(elem,'__nicescroll')||false; (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value); return this; } }; /* $.fx.step["scrollTop"] = function(fx){ $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit ); }; */ jQuery.fn.scrollTop = function(value) { if (typeof value == "undefined") { var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); } else { return this.each(function() { var nice = $.data(this,'__nicescroll')||false; (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value); }); } } // override jQuery scrollLeft var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function $.cssHooks.pageXOffset = { get: function(elem,computed,extra) { var nice = $.data(elem,'__nicescroll')||false; return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); }, set: function(elem,value) { var nice = $.data(elem,'__nicescroll')||false; (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value); return this; } }; /* $.fx.step["scrollLeft"] = function(fx){ $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit ); }; */ jQuery.fn.scrollLeft = function(value) { if (typeof value == "undefined") { var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); } else { return this.each(function() { var nice = $.data(this,'__nicescroll')||false; (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value); }); } } var NiceScrollArray = function(doms) { var self = this; this.length = 0; this.name = "nicescrollarray"; this.each = function(fn) { for(var a=0,i=0;a<self.length;a++) fn.call(self[a],i++); return self; }; this.push = function(nice) { self[self.length]=nice; self.length++; }; this.eq = function(idx) { return self[idx]; }; if (doms) { for(a=0;a<doms.length;a++) { var nice = $.data(doms[a],'__nicescroll')||false; if (nice) { this[this.length]=nice; this.length++; } }; } return this; }; function mplex(el,lst,fn) { for(var a=0;a<lst.length;a++) fn(el,lst[a]); }; mplex( NiceScrollArray.prototype, ['show','hide','toggle','onResize','resize','remove','stop','doScrollPos'], function(e,n) { e[n] = function(){ var args = arguments; return this.each(function(){ this[n].apply(this,args); }); }; } ); jQuery.fn.getNiceScroll = function(index) { if (typeof index == "undefined") { return new NiceScrollArray(this); } else { var nice = this[index]&&$.data(this[index],'__nicescroll')||false; return nice; } }; jQuery.extend(jQuery.expr[':'], { nicescroll: function(a) { return ($.data(a,'__nicescroll'))?true:false; } }); $.fn.niceScroll = function(wrapper,opt) { if (typeof opt=="undefined") { if ((typeof wrapper=="object")&&!("jquery" in wrapper)) { opt = wrapper; wrapper = false; } } var ret = new NiceScrollArray(); if (typeof opt=="undefined") opt = {}; if (wrapper||false) { opt.doc = $(wrapper); opt.win = $(this); } var docundef = !("doc" in opt); if (!docundef&&!("win" in opt)) opt.win = $(this); this.each(function() { var nice = $(this).data('__nicescroll')||false; if (!nice) { opt.doc = (docundef) ? $(this) : opt.doc; nice = new NiceScrollClass(opt,$(this)); $(this).data('__nicescroll',nice); } ret.push(nice); }); return (ret.length==1) ? ret[0] : ret; }; window.NiceScroll = { getjQuery:function(){return jQuery} }; if (!$.nicescroll) { $.nicescroll = new NiceScrollArray(); $.nicescroll.options = _globaloptions; } })( jQuery );